ChemNet > CAS > 57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
Ürün Adı |
methyl 2-[(cyanomethyl)thio]benzoate |
ingilizce adı |
methyl 2-[(cyanomethyl)thio]benzoate;methyl 2-[(cyanomethyl)sulfanyl]benzoate |
Moleküler Formülü |
C10H9NO2S |
Molekül Ağırlığı |
207.249 |
InChI |
InChI=1/C10H9NO2S/c1-13-10(12)8-4-2-3-5-9(8)14-7-6-11/h2-5H,7H2,1H3 |
CAS kayıt numarası |
57601-89-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.24g/cm3 |
Ergime noktası |
121℃ |
Kaynama noktası |
338.6°C at 760 mmHg |
Kırılma indisi |
1.574 |
Alevlenme noktası |
158.6°C |
Buhar basıncı |
9.69E-05mmHg at 25°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|